C7H9IN2OS — CID 114771704
2-iodo-5-(2-methylthiolan-2-yl)-1,3,4-oxadiazole (PubChem CID 114771704) has the molecular formula C7H9IN2OS and a molecular weight of 296.13 g/mol. Its IUPAC name is 2-iodo-5-(2-methylthiolan-2-yl)-1,3,4-oxadiazole.
| Compound Name | 2-iodo-5-(2-methylthiolan-2-yl)-1,3,4-oxadiazole |
|---|---|
| PubChem CID | 114771704 |
| Molecular Formula | C7H9IN2OS |
| Molecular Weight | 296.13 g/mol |
| Exact Mass | 295.95 |
| IUPAC Name | 2-iodo-5-(2-methylthiolan-2-yl)-1,3,4-oxadiazole |
| SMILES | CC1(c2nnc(I)o2)CCCS1 |
| InChI | InChI=1S/C7H9IN2OS/c1-7(3-2-4-12-7)5-9-10-6(8)11-5/h2-4H2,1H3 |
| InChIKey | IIUDGWFAJWXQRK-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 38.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.13 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|