C8H7IN2OS — CID 114771810
2-(3-ethylthiophen-2-yl)-5-iodo-1,3,4-oxadiazole (PubChem CID 114771810) has the molecular formula C8H7IN2OS and a molecular weight of 306.13 g/mol. Its IUPAC name is 2-(3-ethylthiophen-2-yl)-5-iodo-1,3,4-oxadiazole.
| Compound Name | 2-(3-ethylthiophen-2-yl)-5-iodo-1,3,4-oxadiazole |
|---|---|
| PubChem CID | 114771810 |
| Molecular Formula | C8H7IN2OS |
| Molecular Weight | 306.13 g/mol |
| Exact Mass | 305.93 |
| IUPAC Name | 2-(3-ethylthiophen-2-yl)-5-iodo-1,3,4-oxadiazole |
| SMILES | CCc1ccsc1-c1nnc(I)o1 |
| InChI | InChI=1S/C8H7IN2OS/c1-2-5-3-4-13-6(5)7-10-11-8(9)12-7/h3-4H,2H2,1H3 |
| InChIKey | KFWGFFPEELNIEH-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 38.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.13 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|