C10H15IN2O — CID 114771885
2-(cycloheptylmethyl)-5-iodo-1,3,4-oxadiazole (PubChem CID 114771885) has the molecular formula C10H15IN2O and a molecular weight of 306.15 g/mol. Its IUPAC name is 2-(cycloheptylmethyl)-5-iodo-1,3,4-oxadiazole.
| Compound Name | 2-(cycloheptylmethyl)-5-iodo-1,3,4-oxadiazole |
|---|---|
| PubChem CID | 114771885 |
| Molecular Formula | C10H15IN2O |
| Molecular Weight | 306.15 g/mol |
| Exact Mass | 306.02 |
| IUPAC Name | 2-(cycloheptylmethyl)-5-iodo-1,3,4-oxadiazole |
| SMILES | Ic1nnc(CC2CCCCCC2)o1 |
| InChI | InChI=1S/C10H15IN2O/c11-10-13-12-9(14-10)7-8-5-3-1-2-4-6-8/h8H,1-7H2 |
| InChIKey | XCHPFNYFGCSRBO-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 38.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.15 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|