C25H26Cl2N4O2 — CID 11477271
6-[3-(3-imidazol-1-ylpropylamino)propyl]indeno[1,2-c]isoquinoline-5,11-dione;dihydrochloride (PubChem CID 11477271) has the molecular formula C25H26Cl2N4O2 and a molecular weight of 485.42 g/mol. Its IUPAC name is 6-[3-(3-imidazol-1-ylpropylamino)propyl]indeno[1,2-c]isoquinoline-5,11-dione;dihydrochloride.
| Compound Name | 6-[3-(3-imidazol-1-ylpropylamino)propyl]indeno[1,2-c]isoquinoline-5,11-dione;dihydrochloride |
|---|---|
| PubChem CID | 11477271 |
| Molecular Formula | C25H26Cl2N4O2 |
| Molecular Weight | 485.42 g/mol |
| Exact Mass | 484.14 |
| IUPAC Name | 6-[3-(3-imidazol-1-ylpropylamino)propyl]indeno[1,2-c]isoquinoline-5,11-dione;dihydrochloride |
| SMILES | Cl.Cl.O=C1c2ccccc2-c2c1c1ccccc1c(=O)n2CCCNCCCn1ccnc1 |
| InChI | InChI=1S/C25H24N4O2.2ClH/c30-24-20-9-3-2-8-19(20)23-22(24)18-7-1-4-10-21(18)25(31)29(23)15-6-12-26-11-5-14-28-16-13-27-17-28;;/h1-4,7-10,13,16-17,26H,5-6,11-12,14-15H2;2*1H |
| InChIKey | SWFWUYBAXWOUQJ-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 68.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.42 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'keto_phenone_A(11)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|