C15H20FIO — CID 114772726
1-fluoro-2-[2-iodo-1-(2-methylcyclohexyl)oxyethyl]benzene (PubChem CID 114772726) has the molecular formula C15H20FIO and a molecular weight of 362.23 g/mol. Its IUPAC name is 1-fluoro-2-[2-iodo-1-(2-methylcyclohexyl)oxyethyl]benzene.
| Compound Name | 1-fluoro-2-[2-iodo-1-(2-methylcyclohexyl)oxyethyl]benzene |
|---|---|
| PubChem CID | 114772726 |
| Molecular Formula | C15H20FIO |
| Molecular Weight | 362.23 g/mol |
| Exact Mass | 362.05 |
| IUPAC Name | 1-fluoro-2-[2-iodo-1-(2-methylcyclohexyl)oxyethyl]benzene |
| SMILES | CC1CCCCC1OC(CI)c1ccccc1F |
| InChI | InChI=1S/C15H20FIO/c1-11-6-2-5-9-14(11)18-15(10-17)12-7-3-4-8-13(12)16/h3-4,7-8,11,14-15H,2,5-6,9-10H2,1H3 |
| InChIKey | UEVDICVTRRWIEK-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.23 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|