C19H16F6O6S — CID 11477293
[(2R,3R)-4,4,4-trifluoro-1-phenylmethoxy-3-(trifluoromethylsulfonyloxy)butan-2-yl] benzoate (PubChem CID 11477293) has the molecular formula C19H16F6O6S and a molecular weight of 486.39 g/mol. Its IUPAC name is [(2R,3R)-4,4,4-trifluoro-1-phenylmethoxy-3-(trifluoromethylsulfonyloxy)butan-2-yl] benzoate.
| Compound Name | [(2R,3R)-4,4,4-trifluoro-1-phenylmethoxy-3-(trifluoromethylsulfonyloxy)butan-2-yl] benzoate |
|---|---|
| PubChem CID | 11477293 |
| Molecular Formula | C19H16F6O6S |
| Molecular Weight | 486.39 g/mol |
| Exact Mass | 486.06 |
| IUPAC Name | [(2R,3R)-4,4,4-trifluoro-1-phenylmethoxy-3-(trifluoromethylsulfonyloxy)butan-2-yl] benzoate |
| SMILES | O=C(O[C@H](COCc1ccccc1)[C@@H](OS(=O)(=O)C(F)(F)F)C(F)(F)F)c1ccccc1 |
| InChI | InChI=1S/C19H16F6O6S/c20-18(21,22)16(31-32(27,28)19(23,24)25)15(12-29-11-13-7-3-1-4-8-13)30-17(26)14-9-5-2-6-10-14/h1-10,15-16H,11-12H2/t15-,16-/m1/s1 |
| InChIKey | FORZMSNVEXYZGB-HZPDHXFCSA-N |
| XLogP | 4.23 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.39 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|