About 6-bromo-3-[(2S,5R)-5-(6-bromo-1H-indol-3-yl)-1-methylpiperazin-2-yl]-1H-indole
6-bromo-3-[(2S,5R)-5-(6-bromo-1H-indol-3-yl)-1-methylpiperazin-2-yl]-1H-indole (PubChem CID 11477326) has the molecular formula C21H20Br2N4
and a molecular weight of 488.23 g/mol. Its IUPAC name is 6-bromo-3-[(2S,5R)-5-(6-bromo-1H-indol-3-yl)-1-methylpiperazin-2-yl]-1H-indole.
Molecular Properties
| Compound Name | 6-bromo-3-[(2S,5R)-5-(6-bromo-1H-indol-3-yl)-1-methylpiperazin-2-yl]-1H-indole |
| PubChem CID | 11477326 |
| Molecular Formula | C21H20Br2N4 |
| Molecular Weight | 488.23 g/mol |
| Exact Mass | 486.01 |
| IUPAC Name | 6-bromo-3-[(2S,5R)-5-(6-bromo-1H-indol-3-yl)-1-methylpiperazin-2-yl]-1H-indole |
| SMILES | CN1C[C@@H](c2c[nH]c3cc(Br)ccc23)NC[C@@H]1c1c[nH]c2cc(Br)ccc12 |
| InChI | InChI=1S/C21H20Br2N4/c1-27-11-20(16-8-24-18-6-12(22)2-4-14(16)18)26-10-21(27)17-9-25-19-7-13(23)3-5-15(17)19/h2-9,20-21,24-26H,10-11H2,1H3/t20-,21+/m0/s1 |
| InChIKey | XQSOLGAZPINGFW-LEWJYISDSA-N |
| XLogP | 5.49 |
| TPSA | 46.85 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 488.23 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 6-bromo-3-[(2S,5R)-5-(6-bromo-1H-indol-3-yl)-1-methylpiperazin-2-yl]-1H-indole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-bromo-3-[(2S,5R)-5-(6-bromo-1H-indol-3-yl)-1-methylpiperazin-2-yl]-1H-indole?
The IUPAC name of 6-bromo-3-[(2S,5R)-5-(6-bromo-1H-indol-3-yl)-1-methylpiperazin-2-yl]-1H-indole (CID 11477326) is 6-bromo-3-[(2S,5R)-5-(6-bromo-1H-indol-3-yl)-1-methylpiperazin-2-yl]-1H-indole.
What is the SMILES notation for 6-bromo-3-[(2S,5R)-5-(6-bromo-1H-indol-3-yl)-1-methylpiperazin-2-yl]-1H-indole?
The canonical SMILES for 6-bromo-3-[(2S,5R)-5-(6-bromo-1H-indol-3-yl)-1-methylpiperazin-2-yl]-1H-indole is CN1C[C@@H](c2c[nH]c3cc(Br)ccc23)NC[C@@H]1c1c[nH]c2cc(Br)ccc12.
What is the InChIKey of 6-bromo-3-[(2S,5R)-5-(6-bromo-1H-indol-3-yl)-1-methylpiperazin-2-yl]-1H-indole?
The InChIKey is XQSOLGAZPINGFW-LEWJYISDSA-N. The full InChI is InChI=1S/C21H20Br2N4/c1-27-11-20(16-8-24-18-6-12(22)2-4-14(16)18)26-10-21(27)17-9-25-19-7-13(23)3-5-15(17)19/h2-9,20-21,24-26H,10-11H2,1H3/t20-,21+/m0/s1.
What are the key properties of 6-bromo-3-[(2S,5R)-5-(6-bromo-1H-indol-3-yl)-1-methylpiperazin-2-yl]-1H-indole?
6-bromo-3-[(2S,5R)-5-(6-bromo-1H-indol-3-yl)-1-methylpiperazin-2-yl]-1H-indole has a molecular weight of 488.23 g/mol, XLogP of 5.49, 2 rotatable bonds, 3 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6-bromo-3-[(2S,5R)-5-(6-bromo-1H-indol-3-yl)-1-methylpiperazin-2-yl]-1H-indole is sourced from PubChem (CID 11477326), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).