About CID 11477337
CID 11477337 (PubChem CID 11477337) has the molecular formula C25H26
and a molecular weight of 326.48 g/mol.
Molecular Properties
| Compound Name | CID 11477337 |
| PubChem CID | 11477337 |
| Molecular Formula | C25H26 |
| Molecular Weight | 326.48 g/mol |
| Exact Mass | 326.20 |
| IUPAC Name | — |
| SMILES | CC1=CC=C(C)[C]2[C](CCC[C]3[CH][CH][C]4[C]3C(C)=CC=C4C)[CH][CH][C]21 |
| InChI | InChI=1S/C25H26/c1-16-8-10-18(3)24-20(12-14-22(16)24)6-5-7-21-13-15-23-17(2)9-11-19(4)25(21)23/h8-15H,5-7H2,1-4H3 |
| InChIKey | VNIIBPRACWKWIC-UHFFFAOYSA-N |
| XLogP | 6.26 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 326.48 |
| LogP ≤ 5 | 6.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze CID 11477337 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 11477337?
The IUPAC name of CID 11477337 (CID 11477337) is not available.
What is the SMILES notation for CID 11477337?
The canonical SMILES for CID 11477337 is CC1=CC=C(C)[C]2[C](CCC[C]3[CH][CH][C]4[C]3C(C)=CC=C4C)[CH][CH][C]21.
What is the InChIKey of CID 11477337?
The InChIKey is VNIIBPRACWKWIC-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H26/c1-16-8-10-18(3)24-20(12-14-22(16)24)6-5-7-21-13-15-23-17(2)9-11-19(4)25(21)23/h8-15H,5-7H2,1-4H3.
What are the key properties of CID 11477337?
CID 11477337 has a molecular weight of 326.48 g/mol, XLogP of 6.26, 4 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for CID 11477337 is sourced from PubChem (CID 11477337), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).