C21H24F5N5O3 — CID 11477355
tert-butyl N-[(2R)-1-(2,5-difluorophenyl)-4-oxo-4-[3-(trifluoromethyl)-6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazin-7-yl]butan-2-yl]carbamate (PubChem CID 11477355) has the molecular formula C21H24F5N5O3 and a molecular weight of 489.45 g/mol. Its IUPAC name is tert-butyl N-[(2R)-1-(2,5-difluorophenyl)-4-oxo-4-[3-(trifluoromethyl)-6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazin-7-yl]butan-2-yl]carbamate.
| Compound Name | tert-butyl N-[(2R)-1-(2,5-difluorophenyl)-4-oxo-4-[3-(trifluoromethyl)-6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazin-7-yl]butan-2-yl]carbamate |
|---|---|
| PubChem CID | 11477355 |
| Molecular Formula | C21H24F5N5O3 |
| Molecular Weight | 489.45 g/mol |
| Exact Mass | 489.18 |
| IUPAC Name | tert-butyl N-[(2R)-1-(2,5-difluorophenyl)-4-oxo-4-[3-(trifluoromethyl)-6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazin-7-yl]butan-2-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)N[C@@H](CC(=O)N1CCn2c(nnc2C(F)(F)F)C1)Cc1cc(F)ccc1F |
| InChI | InChI=1S/C21H24F5N5O3/c1-20(2,3)34-19(33)27-14(9-12-8-13(22)4-5-15(12)23)10-17(32)30-6-7-31-16(11-30)28-29-18(31)21(24,25)26/h4-5,8,14H,6-7,9-11H2,1-3H3,(H,27,33)/t14-/m1/s1 |
| InChIKey | AXHCIYKYKSIHCB-CQSZACIVSA-N |
| XLogP | 3.44 |
| TPSA | 89.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.45 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |