C30H39FN4O — CID 11477384
1-(2,3-dimethyl-1H-indol-6-yl)-3-[(1R,2S)-2-[[(3S)-3-[(4-fluorophenyl)methyl]piperidin-1-yl]methyl]cyclohexyl]urea (PubChem CID 11477384) has the molecular formula C30H39FN4O and a molecular weight of 490.67 g/mol. Its IUPAC name is 1-(2,3-dimethyl-1H-indol-6-yl)-3-[(1R,2S)-2-[[(3S)-3-[(4-fluorophenyl)methyl]piperidin-1-yl]methyl]cyclohexyl]urea.
| Compound Name | 1-(2,3-dimethyl-1H-indol-6-yl)-3-[(1R,2S)-2-[[(3S)-3-[(4-fluorophenyl)methyl]piperidin-1-yl]methyl]cyclohexyl]urea |
|---|---|
| PubChem CID | 11477384 |
| Molecular Formula | C30H39FN4O |
| Molecular Weight | 490.67 g/mol |
| Exact Mass | 490.31 |
| IUPAC Name | 1-(2,3-dimethyl-1H-indol-6-yl)-3-[(1R,2S)-2-[[(3S)-3-[(4-fluorophenyl)methyl]piperidin-1-yl]methyl]cyclohexyl]urea |
| SMILES | Cc1[nH]c2cc(NC(=O)N[C@@H]3CCCC[C@H]3CN3CCC[C@@H](Cc4ccc(F)cc4)C3)ccc2c1C |
| InChI | InChI=1S/C30H39FN4O/c1-20-21(2)32-29-17-26(13-14-27(20)29)33-30(36)34-28-8-4-3-7-24(28)19-35-15-5-6-23(18-35)16-22-9-11-25(31)12-10-22/h9-14,17,23-24,28,32H,3-8,15-16,18-19H2,1-2H3,(H2,33,34,36)/t23-,24-,28+/m0/s1 |
| InChIKey | QJHXQMJXEVMHTH-IBGGVINMSA-N |
| XLogP | 6.56 |
| TPSA | 60.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.67 |
| LogP ≤ 5 | 6.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|