C19H23F3N4O4S2 — CID 11477412
N-[4-[[4-methyl-5-[4-methylsulfonyl-3-(trifluoromethyl)phenyl]-1,3-thiazol-2-yl]carbamoylamino]butyl]acetamide (PubChem CID 11477412) has the molecular formula C19H23F3N4O4S2 and a molecular weight of 492.55 g/mol. Its IUPAC name is N-[4-[[4-methyl-5-[4-methylsulfonyl-3-(trifluoromethyl)phenyl]-1,3-thiazol-2-yl]carbamoylamino]butyl]acetamide.
| Compound Name | N-[4-[[4-methyl-5-[4-methylsulfonyl-3-(trifluoromethyl)phenyl]-1,3-thiazol-2-yl]carbamoylamino]butyl]acetamide |
|---|---|
| PubChem CID | 11477412 |
| Molecular Formula | C19H23F3N4O4S2 |
| Molecular Weight | 492.55 g/mol |
| Exact Mass | 492.11 |
| IUPAC Name | N-[4-[[4-methyl-5-[4-methylsulfonyl-3-(trifluoromethyl)phenyl]-1,3-thiazol-2-yl]carbamoylamino]butyl]acetamide |
| SMILES | CC(=O)NCCCCNC(=O)Nc1nc(C)c(-c2ccc(S(C)(=O)=O)c(C(F)(F)F)c2)s1 |
| InChI | InChI=1S/C19H23F3N4O4S2/c1-11-16(13-6-7-15(32(3,29)30)14(10-13)19(20,21)22)31-18(25-11)26-17(28)24-9-5-4-8-23-12(2)27/h6-7,10H,4-5,8-9H2,1-3H3,(H,23,27)(H2,24,25,26,28) |
| InChIKey | FEJOOCGKAXCCOW-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 117.26 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.55 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|