C12H21IO3S — CID 114774333
3-(3-ethylcyclohexyl)oxy-4-iodothiolane 1,1-dioxide (PubChem CID 114774333) has the molecular formula C12H21IO3S and a molecular weight of 372.27 g/mol. Its IUPAC name is 3-(3-ethylcyclohexyl)oxy-4-iodothiolane 1,1-dioxide.
| Compound Name | 3-(3-ethylcyclohexyl)oxy-4-iodothiolane 1,1-dioxide |
|---|---|
| PubChem CID | 114774333 |
| Molecular Formula | C12H21IO3S |
| Molecular Weight | 372.27 g/mol |
| Exact Mass | 372.03 |
| IUPAC Name | 3-(3-ethylcyclohexyl)oxy-4-iodothiolane 1,1-dioxide |
| SMILES | CCC1CCCC(OC2CS(=O)(=O)CC2I)C1 |
| InChI | InChI=1S/C12H21IO3S/c1-2-9-4-3-5-10(6-9)16-12-8-17(14,15)7-11(12)13/h9-12H,2-8H2,1H3 |
| InChIKey | WOUBFKLUWWPMKV-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.27 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|