C18H33IO — CID 114774360
1-(3,4-dimethylcyclohexyl)oxy-1-(iodomethyl)-4-propylcyclohexane (PubChem CID 114774360) has the molecular formula C18H33IO and a molecular weight of 392.37 g/mol. Its IUPAC name is 1-(3,4-dimethylcyclohexyl)oxy-1-(iodomethyl)-4-propylcyclohexane.
| Compound Name | 1-(3,4-dimethylcyclohexyl)oxy-1-(iodomethyl)-4-propylcyclohexane |
|---|---|
| PubChem CID | 114774360 |
| Molecular Formula | C18H33IO |
| Molecular Weight | 392.37 g/mol |
| Exact Mass | 392.16 |
| IUPAC Name | 1-(3,4-dimethylcyclohexyl)oxy-1-(iodomethyl)-4-propylcyclohexane |
| SMILES | CCCC1CCC(CI)(OC2CCC(C)C(C)C2)CC1 |
| InChI | InChI=1S/C18H33IO/c1-4-5-16-8-10-18(13-19,11-9-16)20-17-7-6-14(2)15(3)12-17/h14-17H,4-13H2,1-3H3 |
| InChIKey | GIGPDAWNVPKUNC-UHFFFAOYSA-N |
| XLogP | 5.99 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.37 |
| LogP ≤ 5 | 5.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|