About [1-bromo-2-(3,4-dimethylcyclohexyl)oxypropan-2-yl]benzene
[1-bromo-2-(3,4-dimethylcyclohexyl)oxypropan-2-yl]benzene (PubChem CID 114774396) has the molecular formula C17H25BrO
and a molecular weight of 325.29 g/mol. Its IUPAC name is [1-bromo-2-(3,4-dimethylcyclohexyl)oxypropan-2-yl]benzene.
Molecular Properties
| Compound Name | [1-bromo-2-(3,4-dimethylcyclohexyl)oxypropan-2-yl]benzene |
| PubChem CID | 114774396 |
| Molecular Formula | C17H25BrO |
| Molecular Weight | 325.29 g/mol |
| Exact Mass | 324.11 |
| IUPAC Name | [1-bromo-2-(3,4-dimethylcyclohexyl)oxypropan-2-yl]benzene |
| SMILES | CC1CCC(OC(C)(CBr)c2ccccc2)CC1C |
| InChI | InChI=1S/C17H25BrO/c1-13-9-10-16(11-14(13)2)19-17(3,12-18)15-7-5-4-6-8-15/h4-8,13-14,16H,9-12H2,1-3H3 |
| InChIKey | WRBXJFIGASKRAI-UHFFFAOYSA-N |
| XLogP | 5.14 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 325.29 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze [1-bromo-2-(3,4-dimethylcyclohexyl)oxypropan-2-yl]benzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [1-bromo-2-(3,4-dimethylcyclohexyl)oxypropan-2-yl]benzene?
The IUPAC name of [1-bromo-2-(3,4-dimethylcyclohexyl)oxypropan-2-yl]benzene (CID 114774396) is [1-bromo-2-(3,4-dimethylcyclohexyl)oxypropan-2-yl]benzene.
What is the SMILES notation for [1-bromo-2-(3,4-dimethylcyclohexyl)oxypropan-2-yl]benzene?
The canonical SMILES for [1-bromo-2-(3,4-dimethylcyclohexyl)oxypropan-2-yl]benzene is CC1CCC(OC(C)(CBr)c2ccccc2)CC1C.
What is the InChIKey of [1-bromo-2-(3,4-dimethylcyclohexyl)oxypropan-2-yl]benzene?
The InChIKey is WRBXJFIGASKRAI-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H25BrO/c1-13-9-10-16(11-14(13)2)19-17(3,12-18)15-7-5-4-6-8-15/h4-8,13-14,16H,9-12H2,1-3H3.
What are the key properties of [1-bromo-2-(3,4-dimethylcyclohexyl)oxypropan-2-yl]benzene?
[1-bromo-2-(3,4-dimethylcyclohexyl)oxypropan-2-yl]benzene has a molecular weight of 325.29 g/mol, XLogP of 5.14, 4 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for [1-bromo-2-(3,4-dimethylcyclohexyl)oxypropan-2-yl]benzene is sourced from PubChem (CID 114774396), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).