C14H20BrIO — CID 114774507
1-bromo-4-[1-(3,3-dimethylbutoxy)-2-iodoethyl]benzene (PubChem CID 114774507) has the molecular formula C14H20BrIO and a molecular weight of 411.12 g/mol. Its IUPAC name is 1-bromo-4-[1-(3,3-dimethylbutoxy)-2-iodoethyl]benzene.
| Compound Name | 1-bromo-4-[1-(3,3-dimethylbutoxy)-2-iodoethyl]benzene |
|---|---|
| PubChem CID | 114774507 |
| Molecular Formula | C14H20BrIO |
| Molecular Weight | 411.12 g/mol |
| Exact Mass | 409.97 |
| IUPAC Name | 1-bromo-4-[1-(3,3-dimethylbutoxy)-2-iodoethyl]benzene |
| SMILES | CC(C)(C)CCOC(CI)c1ccc(Br)cc1 |
| InChI | InChI=1S/C14H20BrIO/c1-14(2,3)8-9-17-13(10-16)11-4-6-12(15)7-5-11/h4-7,13H,8-10H2,1-3H3 |
| InChIKey | DZGOLTPFUHKRDD-UHFFFAOYSA-N |
| XLogP | 5.38 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.12 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|