C13H22F3IO — CID 114774964
1-(iodomethyl)-4-propan-2-yl-1-(3,3,3-trifluoropropoxy)cyclohexane (PubChem CID 114774964) has the molecular formula C13H22F3IO and a molecular weight of 378.22 g/mol. Its IUPAC name is 1-(iodomethyl)-4-propan-2-yl-1-(3,3,3-trifluoropropoxy)cyclohexane.
| Compound Name | 1-(iodomethyl)-4-propan-2-yl-1-(3,3,3-trifluoropropoxy)cyclohexane |
|---|---|
| PubChem CID | 114774964 |
| Molecular Formula | C13H22F3IO |
| Molecular Weight | 378.22 g/mol |
| Exact Mass | 378.07 |
| IUPAC Name | 1-(iodomethyl)-4-propan-2-yl-1-(3,3,3-trifluoropropoxy)cyclohexane |
| SMILES | CC(C)C1CCC(CI)(OCCC(F)(F)F)CC1 |
| InChI | InChI=1S/C13H22F3IO/c1-10(2)11-3-5-12(9-17,6-4-11)18-8-7-13(14,15)16/h10-11H,3-9H2,1-2H3 |
| InChIKey | TWRBSSJMIJSJKI-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.22 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|