C24H32F4N4O3 — CID 11477560
3-(cyclopropylamino)-4-methyl-1-[3-[4-[2-(2,2,3,3-tetrafluoropropoxy)phenyl]piperazin-1-yl]propyl]pyrrolidine-2,5-dione (PubChem CID 11477560) has the molecular formula C24H32F4N4O3 and a molecular weight of 500.54 g/mol. Its IUPAC name is 3-(cyclopropylamino)-4-methyl-1-[3-[4-[2-(2,2,3,3-tetrafluoropropoxy)phenyl]piperazin-1-yl]propyl]pyrrolidine-2,5-dione.
| Compound Name | 3-(cyclopropylamino)-4-methyl-1-[3-[4-[2-(2,2,3,3-tetrafluoropropoxy)phenyl]piperazin-1-yl]propyl]pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 11477560 |
| Molecular Formula | C24H32F4N4O3 |
| Molecular Weight | 500.54 g/mol |
| Exact Mass | 500.24 |
| IUPAC Name | 3-(cyclopropylamino)-4-methyl-1-[3-[4-[2-(2,2,3,3-tetrafluoropropoxy)phenyl]piperazin-1-yl]propyl]pyrrolidine-2,5-dione |
| SMILES | CC1C(=O)N(CCCN2CCN(c3ccccc3OCC(F)(F)C(F)F)CC2)C(=O)C1NC1CC1 |
| InChI | InChI=1S/C24H32F4N4O3/c1-16-20(29-17-7-8-17)22(34)32(21(16)33)10-4-9-30-11-13-31(14-12-30)18-5-2-3-6-19(18)35-15-24(27,28)23(25)26/h2-3,5-6,16-17,20,23,29H,4,7-15H2,1H3 |
| InChIKey | ZJAJQMLTSOPINE-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 65.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.54 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|