C14H23N3O3 — CID 114775746
2,2-dimethyl-6-[(6-propoxypyrazin-2-yl)oxymethyl]morpholine (PubChem CID 114775746) has the molecular formula C14H23N3O3 and a molecular weight of 281.36 g/mol. Its IUPAC name is 2,2-dimethyl-6-[(6-propoxypyrazin-2-yl)oxymethyl]morpholine.
| Compound Name | 2,2-dimethyl-6-[(6-propoxypyrazin-2-yl)oxymethyl]morpholine |
|---|---|
| PubChem CID | 114775746 |
| Molecular Formula | C14H23N3O3 |
| Molecular Weight | 281.36 g/mol |
| Exact Mass | 281.17 |
| IUPAC Name | 2,2-dimethyl-6-[(6-propoxypyrazin-2-yl)oxymethyl]morpholine |
| SMILES | CCCOc1cncc(OCC2CNCC(C)(C)O2)n1 |
| InChI | InChI=1S/C14H23N3O3/c1-4-5-18-12-7-15-8-13(17-12)19-9-11-6-16-10-14(2,3)20-11/h7-8,11,16H,4-6,9-10H2,1-3H3 |
| InChIKey | ATJWKVCHBUBSSJ-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 65.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.36 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |