About methyl 4-[(6,6-dimethylmorpholin-2-yl)methoxy]pyridine-2-carboxylate
methyl 4-[(6,6-dimethylmorpholin-2-yl)methoxy]pyridine-2-carboxylate (PubChem CID 114775805) has the molecular formula C14H20N2O4
and a molecular weight of 280.32 g/mol. Its IUPAC name is methyl 4-[(6,6-dimethylmorpholin-2-yl)methoxy]pyridine-2-carboxylate.
Molecular Properties
| Compound Name | methyl 4-[(6,6-dimethylmorpholin-2-yl)methoxy]pyridine-2-carboxylate |
| PubChem CID | 114775805 |
| Molecular Formula | C14H20N2O4 |
| Molecular Weight | 280.32 g/mol |
| Exact Mass | 280.14 |
| IUPAC Name | methyl 4-[(6,6-dimethylmorpholin-2-yl)methoxy]pyridine-2-carboxylate |
| SMILES | COC(=O)c1cc(OCC2CNCC(C)(C)O2)ccn1 |
| InChI | InChI=1S/C14H20N2O4/c1-14(2)9-15-7-11(20-14)8-19-10-4-5-16-12(6-10)13(17)18-3/h4-6,11,15H,7-9H2,1-3H3 |
| InChIKey | ABMWORSDEFMZAP-UHFFFAOYSA-N |
| XLogP | 1.01 |
| TPSA | 69.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 280.32 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze methyl 4-[(6,6-dimethylmorpholin-2-yl)methoxy]pyridine-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 4-[(6,6-dimethylmorpholin-2-yl)methoxy]pyridine-2-carboxylate?
The IUPAC name of methyl 4-[(6,6-dimethylmorpholin-2-yl)methoxy]pyridine-2-carboxylate (CID 114775805) is methyl 4-[(6,6-dimethylmorpholin-2-yl)methoxy]pyridine-2-carboxylate.
What is the SMILES notation for methyl 4-[(6,6-dimethylmorpholin-2-yl)methoxy]pyridine-2-carboxylate?
The canonical SMILES for methyl 4-[(6,6-dimethylmorpholin-2-yl)methoxy]pyridine-2-carboxylate is COC(=O)c1cc(OCC2CNCC(C)(C)O2)ccn1.
What is the InChIKey of methyl 4-[(6,6-dimethylmorpholin-2-yl)methoxy]pyridine-2-carboxylate?
The InChIKey is ABMWORSDEFMZAP-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H20N2O4/c1-14(2)9-15-7-11(20-14)8-19-10-4-5-16-12(6-10)13(17)18-3/h4-6,11,15H,7-9H2,1-3H3.
What are the key properties of methyl 4-[(6,6-dimethylmorpholin-2-yl)methoxy]pyridine-2-carboxylate?
methyl 4-[(6,6-dimethylmorpholin-2-yl)methoxy]pyridine-2-carboxylate has a molecular weight of 280.32 g/mol, XLogP of 1.01, 4 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 4-[(6,6-dimethylmorpholin-2-yl)methoxy]pyridine-2-carboxylate is sourced from PubChem (CID 114775805), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).