C30H30FNO5 — CID 11477616
(5Z)-5-[[4-fluoro-2-(methoxymethoxymethyl)phenyl]methylidene]-10-methoxy-2,2,4-trimethyl-1H-chromeno[3,4-f]quinolin-9-ol (PubChem CID 11477616) has the molecular formula C30H30FNO5 and a molecular weight of 503.57 g/mol. Its IUPAC name is (5Z)-5-[[4-fluoro-2-(methoxymethoxymethyl)phenyl]methylidene]-10-methoxy-2,2,4-trimethyl-1H-chromeno[3,4-f]quinolin-9-ol.
| Compound Name | (5Z)-5-[[4-fluoro-2-(methoxymethoxymethyl)phenyl]methylidene]-10-methoxy-2,2,4-trimethyl-1H-chromeno[3,4-f]quinolin-9-ol |
|---|---|
| PubChem CID | 11477616 |
| Molecular Formula | C30H30FNO5 |
| Molecular Weight | 503.57 g/mol |
| Exact Mass | 503.21 |
| IUPAC Name | (5Z)-5-[[4-fluoro-2-(methoxymethoxymethyl)phenyl]methylidene]-10-methoxy-2,2,4-trimethyl-1H-chromeno[3,4-f]quinolin-9-ol |
| SMILES | COCOCc1cc(F)ccc1/C=C1\Oc2ccc(O)c(OC)c2-c2ccc3c(c21)C(C)=CC(C)(C)N3 |
| InChI | InChI=1S/C30H30FNO5/c1-17-14-30(2,3)32-22-9-8-21-27(26(17)22)25(37-24-11-10-23(33)29(35-5)28(21)24)13-18-6-7-20(31)12-19(18)15-36-16-34-4/h6-14,32-33H,15-16H2,1-5H3/b25-13- |
| InChIKey | OTWADYHEAKBKQC-MXAYSNPKSA-N |
| XLogP | 6.83 |
| TPSA | 69.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.57 |
| LogP ≤ 5 | 6.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|