C14H18N2O2 — CID 114776853
4-[6-(hydroxymethyl)-2,2-dimethylmorpholin-4-yl]benzonitrile (PubChem CID 114776853) has the molecular formula C14H18N2O2 and a molecular weight of 246.31 g/mol. Its IUPAC name is 4-[6-(hydroxymethyl)-2,2-dimethylmorpholin-4-yl]benzonitrile.
| Compound Name | 4-[6-(hydroxymethyl)-2,2-dimethylmorpholin-4-yl]benzonitrile |
|---|---|
| PubChem CID | 114776853 |
| Molecular Formula | C14H18N2O2 |
| Molecular Weight | 246.31 g/mol |
| Exact Mass | 246.14 |
| IUPAC Name | 4-[6-(hydroxymethyl)-2,2-dimethylmorpholin-4-yl]benzonitrile |
| SMILES | CC1(C)CN(c2ccc(C#N)cc2)CC(CO)O1 |
| InChI | InChI=1S/C14H18N2O2/c1-14(2)10-16(8-13(9-17)18-14)12-5-3-11(7-15)4-6-12/h3-6,13,17H,8-10H2,1-2H3 |
| InChIKey | AZXOJVHDHOGJFY-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 56.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.31 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |