C15H22ClNO3 — CID 114777393
1-[3-chloro-4-[6-(hydroxymethyl)-2,2-dimethylmorpholin-4-yl]phenyl]ethanol (PubChem CID 114777393) has the molecular formula C15H22ClNO3 and a molecular weight of 299.80 g/mol. Its IUPAC name is 1-[3-chloro-4-[6-(hydroxymethyl)-2,2-dimethylmorpholin-4-yl]phenyl]ethanol.
| Compound Name | 1-[3-chloro-4-[6-(hydroxymethyl)-2,2-dimethylmorpholin-4-yl]phenyl]ethanol |
|---|---|
| PubChem CID | 114777393 |
| Molecular Formula | C15H22ClNO3 |
| Molecular Weight | 299.80 g/mol |
| Exact Mass | 299.13 |
| IUPAC Name | 1-[3-chloro-4-[6-(hydroxymethyl)-2,2-dimethylmorpholin-4-yl]phenyl]ethanol |
| SMILES | CC(O)c1ccc(N2CC(CO)OC(C)(C)C2)c(Cl)c1 |
| InChI | InChI=1S/C15H22ClNO3/c1-10(19)11-4-5-14(13(16)6-11)17-7-12(8-18)20-15(2,3)9-17/h4-6,10,12,18-19H,7-9H2,1-3H3 |
| InChIKey | TYHNCXVWFUEHMQ-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 52.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.80 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'} |
|---|