C33H34O5 — CID 11477741
(2R,3S,4R,5R,6R)-2-phenyl-4,5-bis(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-3-ol (PubChem CID 11477741) has the molecular formula C33H34O5 and a molecular weight of 510.63 g/mol. Its IUPAC name is (2R,3S,4R,5R,6R)-2-phenyl-4,5-bis(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-3-ol.
| Compound Name | (2R,3S,4R,5R,6R)-2-phenyl-4,5-bis(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-3-ol |
|---|---|
| PubChem CID | 11477741 |
| Molecular Formula | C33H34O5 |
| Molecular Weight | 510.63 g/mol |
| Exact Mass | 510.24 |
| IUPAC Name | (2R,3S,4R,5R,6R)-2-phenyl-4,5-bis(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-3-ol |
| SMILES | O[C@@H]1[C@@H](OCc2ccccc2)[C@H](OCc2ccccc2)[C@@H](COCc2ccccc2)O[C@@H]1c1ccccc1 |
| InChI | InChI=1S/C33H34O5/c34-30-31(28-19-11-4-12-20-28)38-29(24-35-21-25-13-5-1-6-14-25)32(36-22-26-15-7-2-8-16-26)33(30)37-23-27-17-9-3-10-18-27/h1-20,29-34H,21-24H2/t29-,30+,31-,32-,33-/m1/s1 |
| InChIKey | YJTGPJSHMXGKDE-CVCQUZQZSA-N |
| XLogP | 5.88 |
| TPSA | 57.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.63 |
| LogP ≤ 5 | 5.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |