About [6,6-dimethyl-4-[5-(methylaminomethyl)pyrimidin-2-yl]morpholin-2-yl]methanol
[6,6-dimethyl-4-[5-(methylaminomethyl)pyrimidin-2-yl]morpholin-2-yl]methanol (PubChem CID 114777537) has the molecular formula C13H22N4O2
and a molecular weight of 266.34 g/mol. Its IUPAC name is [6,6-dimethyl-4-[5-(methylaminomethyl)pyrimidin-2-yl]morpholin-2-yl]methanol.
Molecular Properties
| Compound Name | [6,6-dimethyl-4-[5-(methylaminomethyl)pyrimidin-2-yl]morpholin-2-yl]methanol |
| PubChem CID | 114777537 |
| Molecular Formula | C13H22N4O2 |
| Molecular Weight | 266.34 g/mol |
| Exact Mass | 266.17 |
| IUPAC Name | [6,6-dimethyl-4-[5-(methylaminomethyl)pyrimidin-2-yl]morpholin-2-yl]methanol |
| SMILES | CNCc1cnc(N2CC(CO)OC(C)(C)C2)nc1 |
| InChI | InChI=1S/C13H22N4O2/c1-13(2)9-17(7-11(8-18)19-13)12-15-5-10(4-14-3)6-16-12/h5-6,11,14,18H,4,7-9H2,1-3H3 |
| InChIKey | ZRHXUTKHFYABMG-UHFFFAOYSA-N |
| XLogP | 0.17 |
| TPSA | 70.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 266.34 |
| LogP ≤ 5 | 0.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze [6,6-dimethyl-4-[5-(methylaminomethyl)pyrimidin-2-yl]morpholin-2-yl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [6,6-dimethyl-4-[5-(methylaminomethyl)pyrimidin-2-yl]morpholin-2-yl]methanol?
The IUPAC name of [6,6-dimethyl-4-[5-(methylaminomethyl)pyrimidin-2-yl]morpholin-2-yl]methanol (CID 114777537) is [6,6-dimethyl-4-[5-(methylaminomethyl)pyrimidin-2-yl]morpholin-2-yl]methanol.
What is the SMILES notation for [6,6-dimethyl-4-[5-(methylaminomethyl)pyrimidin-2-yl]morpholin-2-yl]methanol?
The canonical SMILES for [6,6-dimethyl-4-[5-(methylaminomethyl)pyrimidin-2-yl]morpholin-2-yl]methanol is CNCc1cnc(N2CC(CO)OC(C)(C)C2)nc1.
What is the InChIKey of [6,6-dimethyl-4-[5-(methylaminomethyl)pyrimidin-2-yl]morpholin-2-yl]methanol?
The InChIKey is ZRHXUTKHFYABMG-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H22N4O2/c1-13(2)9-17(7-11(8-18)19-13)12-15-5-10(4-14-3)6-16-12/h5-6,11,14,18H,4,7-9H2,1-3H3.
What are the key properties of [6,6-dimethyl-4-[5-(methylaminomethyl)pyrimidin-2-yl]morpholin-2-yl]methanol?
[6,6-dimethyl-4-[5-(methylaminomethyl)pyrimidin-2-yl]morpholin-2-yl]methanol has a molecular weight of 266.34 g/mol, XLogP of 0.17, 4 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [6,6-dimethyl-4-[5-(methylaminomethyl)pyrimidin-2-yl]morpholin-2-yl]methanol is sourced from PubChem (CID 114777537), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).