About [6-(hydroxymethyl)-2,2-dimethylmorpholin-4-yl]-(3-methyl-5-propan-2-yl-1,2-oxazol-4-yl)methanone
[6-(hydroxymethyl)-2,2-dimethylmorpholin-4-yl]-(3-methyl-5-propan-2-yl-1,2-oxazol-4-yl)methanone (PubChem CID 114778454) has the molecular formula C15H24N2O4
and a molecular weight of 296.37 g/mol. Its IUPAC name is [6-(hydroxymethyl)-2,2-dimethylmorpholin-4-yl]-(3-methyl-5-propan-2-yl-1,2-oxazol-4-yl)methanone.
Molecular Properties
| Compound Name | [6-(hydroxymethyl)-2,2-dimethylmorpholin-4-yl]-(3-methyl-5-propan-2-yl-1,2-oxazol-4-yl)methanone |
| PubChem CID | 114778454 |
| Molecular Formula | C15H24N2O4 |
| Molecular Weight | 296.37 g/mol |
| Exact Mass | 296.17 |
| IUPAC Name | [6-(hydroxymethyl)-2,2-dimethylmorpholin-4-yl]-(3-methyl-5-propan-2-yl-1,2-oxazol-4-yl)methanone |
| SMILES | Cc1noc(C(C)C)c1C(=O)N1CC(CO)OC(C)(C)C1 |
| InChI | InChI=1S/C15H24N2O4/c1-9(2)13-12(10(3)16-21-13)14(19)17-6-11(7-18)20-15(4,5)8-17/h9,11,18H,6-8H2,1-5H3 |
| InChIKey | XFJRPASLKIGRJT-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 75.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 296.37 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze [6-(hydroxymethyl)-2,2-dimethylmorpholin-4-yl]-(3-methyl-5-propan-2-yl-1,2-oxazol-4-yl)methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [6-(hydroxymethyl)-2,2-dimethylmorpholin-4-yl]-(3-methyl-5-propan-2-yl-1,2-oxazol-4-yl)methanone?
The IUPAC name of [6-(hydroxymethyl)-2,2-dimethylmorpholin-4-yl]-(3-methyl-5-propan-2-yl-1,2-oxazol-4-yl)methanone (CID 114778454) is [6-(hydroxymethyl)-2,2-dimethylmorpholin-4-yl]-(3-methyl-5-propan-2-yl-1,2-oxazol-4-yl)methanone.
What is the SMILES notation for [6-(hydroxymethyl)-2,2-dimethylmorpholin-4-yl]-(3-methyl-5-propan-2-yl-1,2-oxazol-4-yl)methanone?
The canonical SMILES for [6-(hydroxymethyl)-2,2-dimethylmorpholin-4-yl]-(3-methyl-5-propan-2-yl-1,2-oxazol-4-yl)methanone is Cc1noc(C(C)C)c1C(=O)N1CC(CO)OC(C)(C)C1.
What is the InChIKey of [6-(hydroxymethyl)-2,2-dimethylmorpholin-4-yl]-(3-methyl-5-propan-2-yl-1,2-oxazol-4-yl)methanone?
The InChIKey is XFJRPASLKIGRJT-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H24N2O4/c1-9(2)13-12(10(3)16-21-13)14(19)17-6-11(7-18)20-15(4,5)8-17/h9,11,18H,6-8H2,1-5H3.
What are the key properties of [6-(hydroxymethyl)-2,2-dimethylmorpholin-4-yl]-(3-methyl-5-propan-2-yl-1,2-oxazol-4-yl)methanone?
[6-(hydroxymethyl)-2,2-dimethylmorpholin-4-yl]-(3-methyl-5-propan-2-yl-1,2-oxazol-4-yl)methanone has a molecular weight of 296.37 g/mol, XLogP of 1.72, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [6-(hydroxymethyl)-2,2-dimethylmorpholin-4-yl]-(3-methyl-5-propan-2-yl-1,2-oxazol-4-yl)methanone is sourced from PubChem (CID 114778454), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).