C22H33IO4Si — CID 11477851
(6R)-6-[(1S)-1-[(Z,3S)-1-iodopent-1-en-3-yl]oxy-3-[(4-methoxyphenyl)methoxy]propyl]-2,2-dimethyl-5,6-dihydrooxasiline (PubChem CID 11477851) has the molecular formula C22H33IO4Si and a molecular weight of 516.49 g/mol. Its IUPAC name is (6R)-6-[(1S)-1-[(Z,3S)-1-iodopent-1-en-3-yl]oxy-3-[(4-methoxyphenyl)methoxy]propyl]-2,2-dimethyl-5,6-dihydrooxasiline.
| Compound Name | (6R)-6-[(1S)-1-[(Z,3S)-1-iodopent-1-en-3-yl]oxy-3-[(4-methoxyphenyl)methoxy]propyl]-2,2-dimethyl-5,6-dihydrooxasiline |
|---|---|
| PubChem CID | 11477851 |
| Molecular Formula | C22H33IO4Si |
| Molecular Weight | 516.49 g/mol |
| Exact Mass | 516.12 |
| IUPAC Name | (6R)-6-[(1S)-1-[(Z,3S)-1-iodopent-1-en-3-yl]oxy-3-[(4-methoxyphenyl)methoxy]propyl]-2,2-dimethyl-5,6-dihydrooxasiline |
| SMILES | CC[C@@H](/C=C\I)O[C@@H](CCOCc1ccc(OC)cc1)[C@H]1CC=C[Si](C)(C)O1 |
| InChI | InChI=1S/C22H33IO4Si/c1-5-19(12-14-23)26-21(22-7-6-16-28(3,4)27-22)13-15-25-17-18-8-10-20(24-2)11-9-18/h6,8-12,14,16,19,21-22H,5,7,13,15,17H2,1-4H3/b14-12-/t19-,21-,22+/m0/s1 |
| InChIKey | UFIDDBDGEZCAJF-RENWPJESSA-N |
| XLogP | 5.80 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.49 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|