C27H35Cl2N5O — CID 11477853
4-[[N-cyclohexyl-C-[3-(methylamino)pyrrolidin-1-yl]carbonimidoyl]amino]-N-[2-(2,4-dichlorophenyl)ethyl]benzamide (PubChem CID 11477853) has the molecular formula C27H35Cl2N5O and a molecular weight of 516.52 g/mol. Its IUPAC name is 4-[[N-cyclohexyl-C-[3-(methylamino)pyrrolidin-1-yl]carbonimidoyl]amino]-N-[2-(2,4-dichlorophenyl)ethyl]benzamide.
| Compound Name | 4-[[N-cyclohexyl-C-[3-(methylamino)pyrrolidin-1-yl]carbonimidoyl]amino]-N-[2-(2,4-dichlorophenyl)ethyl]benzamide |
|---|---|
| PubChem CID | 11477853 |
| Molecular Formula | C27H35Cl2N5O |
| Molecular Weight | 516.52 g/mol |
| Exact Mass | 515.22 |
| IUPAC Name | 4-[[N-cyclohexyl-C-[3-(methylamino)pyrrolidin-1-yl]carbonimidoyl]amino]-N-[2-(2,4-dichlorophenyl)ethyl]benzamide |
| SMILES | CNC1CCN(/C(=N\C2CCCCC2)Nc2ccc(C(=O)NCCc3ccc(Cl)cc3Cl)cc2)C1 |
| InChI | InChI=1S/C27H35Cl2N5O/c1-30-24-14-16-34(18-24)27(32-22-5-3-2-4-6-22)33-23-11-8-20(9-12-23)26(35)31-15-13-19-7-10-21(28)17-25(19)29/h7-12,17,22,24,30H,2-6,13-16,18H2,1H3,(H,31,35)(H,32,33) |
| InChIKey | VMEVITMYQPTNSR-UHFFFAOYSA-N |
| XLogP | 5.36 |
| TPSA | 68.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.52 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|