C12H20F3NO4 — CID 114778588
1-[6-(hydroxymethyl)-2,2-dimethylmorpholin-4-yl]-3-(2,2,2-trifluoroethoxy)propan-1-one (PubChem CID 114778588) has the molecular formula C12H20F3NO4 and a molecular weight of 299.29 g/mol. Its IUPAC name is 1-[6-(hydroxymethyl)-2,2-dimethylmorpholin-4-yl]-3-(2,2,2-trifluoroethoxy)propan-1-one.
| Compound Name | 1-[6-(hydroxymethyl)-2,2-dimethylmorpholin-4-yl]-3-(2,2,2-trifluoroethoxy)propan-1-one |
|---|---|
| PubChem CID | 114778588 |
| Molecular Formula | C12H20F3NO4 |
| Molecular Weight | 299.29 g/mol |
| Exact Mass | 299.13 |
| IUPAC Name | 1-[6-(hydroxymethyl)-2,2-dimethylmorpholin-4-yl]-3-(2,2,2-trifluoroethoxy)propan-1-one |
| SMILES | CC1(C)CN(C(=O)CCOCC(F)(F)F)CC(CO)O1 |
| InChI | InChI=1S/C12H20F3NO4/c1-11(2)7-16(5-9(6-17)20-11)10(18)3-4-19-8-12(13,14)15/h9,17H,3-8H2,1-2H3 |
| InChIKey | QTEPHQKYLZSLQY-UHFFFAOYSA-N |
| XLogP | 0.95 |
| TPSA | 59.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.29 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|