C31H54O4Si — CID 11477891
[(4R)-4-[(1R,3R,3aR,7R,7aR)-4-methyl-7-propan-2-yl-3-prop-2-ynyl-1,3,3a,6,7,7a-hexahydro-2-benzofuran-1-yl]-4-[tert-butyl(dimethyl)silyl]oxypentyl] 2,2-dimethylpropanoate (PubChem CID 11477891) has the molecular formula C31H54O4Si and a molecular weight of 518.86 g/mol. Its IUPAC name is [(4R)-4-[(1R,3R,3aR,7R,7aR)-4-methyl-7-propan-2-yl-3-prop-2-ynyl-1,3,3a,6,7,7a-hexahydro-2-benzofuran-1-yl]-4-[tert-butyl(dimethyl)silyl]oxypentyl] 2,2-dimethylpropanoate.
| Compound Name | [(4R)-4-[(1R,3R,3aR,7R,7aR)-4-methyl-7-propan-2-yl-3-prop-2-ynyl-1,3,3a,6,7,7a-hexahydro-2-benzofuran-1-yl]-4-[tert-butyl(dimethyl)silyl]oxypentyl] 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 11477891 |
| Molecular Formula | C31H54O4Si |
| Molecular Weight | 518.86 g/mol |
| Exact Mass | 518.38 |
| IUPAC Name | [(4R)-4-[(1R,3R,3aR,7R,7aR)-4-methyl-7-propan-2-yl-3-prop-2-ynyl-1,3,3a,6,7,7a-hexahydro-2-benzofuran-1-yl]-4-[tert-butyl(dimethyl)silyl]oxypentyl] 2,2-dimethylpropanoate |
| SMILES | C#CC[C@H]1O[C@@H]([C@@](C)(CCCOC(=O)C(C)(C)C)O[Si](C)(C)C(C)(C)C)[C@H]2[C@@H]1C(C)=CC[C@@H]2C(C)C |
| InChI | InChI=1S/C31H54O4Si/c1-14-16-24-25-22(4)17-18-23(21(2)3)26(25)27(34-24)31(11,35-36(12,13)30(8,9)10)19-15-20-33-28(32)29(5,6)7/h1,17,21,23-27H,15-16,18-20H2,2-13H3/t23-,24-,25-,26-,27-,31-/m1/s1 |
| InChIKey | PFCLUCROYNFAMO-RHMYMXAOSA-N |
| XLogP | 7.78 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.86 |
| LogP ≤ 5 | 7.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|