C25H56O5Si3 — CID 11477929
(2R,6R,7R)-1-[tert-butyl(dimethyl)silyl]oxy-6-methyl-5-methylidene-2-(2-trimethylsilylethoxymethoxy)-7-trimethylsilyloxyoctan-3-ol (PubChem CID 11477929) has the molecular formula C25H56O5Si3 and a molecular weight of 520.98 g/mol. Its IUPAC name is (2R,6R,7R)-1-[tert-butyl(dimethyl)silyl]oxy-6-methyl-5-methylidene-2-(2-trimethylsilylethoxymethoxy)-7-trimethylsilyloxyoctan-3-ol.
| Compound Name | (2R,6R,7R)-1-[tert-butyl(dimethyl)silyl]oxy-6-methyl-5-methylidene-2-(2-trimethylsilylethoxymethoxy)-7-trimethylsilyloxyoctan-3-ol |
|---|---|
| PubChem CID | 11477929 |
| Molecular Formula | C25H56O5Si3 |
| Molecular Weight | 520.98 g/mol |
| Exact Mass | 520.34 |
| IUPAC Name | (2R,6R,7R)-1-[tert-butyl(dimethyl)silyl]oxy-6-methyl-5-methylidene-2-(2-trimethylsilylethoxymethoxy)-7-trimethylsilyloxyoctan-3-ol |
| SMILES | C=C(CC(O)[C@@H](CO[Si](C)(C)C(C)(C)C)OCOCC[Si](C)(C)C)[C@@H](C)[C@@H](C)O[Si](C)(C)C |
| InChI | InChI=1S/C25H56O5Si3/c1-20(21(2)22(3)30-32(10,11)12)17-23(26)24(18-29-33(13,14)25(4,5)6)28-19-27-15-16-31(7,8)9/h21-24,26H,1,15-19H2,2-14H3/t21-,22-,23?,24-/m1/s1 |
| InChIKey | SXCMWSJMIZVOIS-ANZSPHHOSA-N |
| XLogP | 6.89 |
| TPSA | 57.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.98 |
| LogP ≤ 5 | 6.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|