C12H21ClF3NO2 — CID 114780461
6-(chloromethyl)-2,2-dimethyl-4-[3-(2,2,2-trifluoroethoxy)propyl]morpholine (PubChem CID 114780461) has the molecular formula C12H21ClF3NO2 and a molecular weight of 303.75 g/mol. Its IUPAC name is 6-(chloromethyl)-2,2-dimethyl-4-[3-(2,2,2-trifluoroethoxy)propyl]morpholine.
| Compound Name | 6-(chloromethyl)-2,2-dimethyl-4-[3-(2,2,2-trifluoroethoxy)propyl]morpholine |
|---|---|
| PubChem CID | 114780461 |
| Molecular Formula | C12H21ClF3NO2 |
| Molecular Weight | 303.75 g/mol |
| Exact Mass | 303.12 |
| IUPAC Name | 6-(chloromethyl)-2,2-dimethyl-4-[3-(2,2,2-trifluoroethoxy)propyl]morpholine |
| SMILES | CC1(C)CN(CCCOCC(F)(F)F)CC(CCl)O1 |
| InChI | InChI=1S/C12H21ClF3NO2/c1-11(2)8-17(7-10(6-13)19-11)4-3-5-18-9-12(14,15)16/h10H,3-9H2,1-2H3 |
| InChIKey | ICAYZKBKKKBBGN-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.75 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|