C13H20BrNOS — CID 114780725
6-(bromomethyl)-2,2-dimethyl-4-(2-thiophen-3-ylethyl)morpholine (PubChem CID 114780725) has the molecular formula C13H20BrNOS and a molecular weight of 318.28 g/mol. Its IUPAC name is 6-(bromomethyl)-2,2-dimethyl-4-(2-thiophen-3-ylethyl)morpholine.
| Compound Name | 6-(bromomethyl)-2,2-dimethyl-4-(2-thiophen-3-ylethyl)morpholine |
|---|---|
| PubChem CID | 114780725 |
| Molecular Formula | C13H20BrNOS |
| Molecular Weight | 318.28 g/mol |
| Exact Mass | 317.04 |
| IUPAC Name | 6-(bromomethyl)-2,2-dimethyl-4-(2-thiophen-3-ylethyl)morpholine |
| SMILES | CC1(C)CN(CCc2ccsc2)CC(CBr)O1 |
| InChI | InChI=1S/C13H20BrNOS/c1-13(2)10-15(8-12(7-14)16-13)5-3-11-4-6-17-9-11/h4,6,9,12H,3,5,7-8,10H2,1-2H3 |
| InChIKey | YUAXVXOJAAUGFK-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.28 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|