C28H56O5Si2 — CID 11478077
tert-butyl-[[(2S,4S,6R,8R,10S)-2-ethenyl-4-methoxy-8-[tri(propan-2-yl)silyloxymethyl]-1,7-dioxaspiro[5.5]undecan-10-yl]oxy]-dimethylsilane (PubChem CID 11478077) has the molecular formula C28H56O5Si2 and a molecular weight of 528.92 g/mol. Its IUPAC name is tert-butyl-[[(2S,4S,6R,8R,10S)-2-ethenyl-4-methoxy-8-[tri(propan-2-yl)silyloxymethyl]-1,7-dioxaspiro[5.5]undecan-10-yl]oxy]-dimethylsilane.
| Compound Name | tert-butyl-[[(2S,4S,6R,8R,10S)-2-ethenyl-4-methoxy-8-[tri(propan-2-yl)silyloxymethyl]-1,7-dioxaspiro[5.5]undecan-10-yl]oxy]-dimethylsilane |
|---|---|
| PubChem CID | 11478077 |
| Molecular Formula | C28H56O5Si2 |
| Molecular Weight | 528.92 g/mol |
| Exact Mass | 528.37 |
| IUPAC Name | tert-butyl-[[(2S,4S,6R,8R,10S)-2-ethenyl-4-methoxy-8-[tri(propan-2-yl)silyloxymethyl]-1,7-dioxaspiro[5.5]undecan-10-yl]oxy]-dimethylsilane |
| SMILES | C=C[C@@H]1C[C@H](OC)C[C@@]2(C[C@@H](O[Si](C)(C)C(C)(C)C)C[C@H](CO[Si](C(C)C)(C(C)C)C(C)C)O2)O1 |
| InChI | InChI=1S/C28H56O5Si2/c1-14-23-15-24(29-11)17-28(31-23)18-25(33-34(12,13)27(8,9)10)16-26(32-28)19-30-35(20(2)3,21(4)5)22(6)7/h14,20-26H,1,15-19H2,2-13H3/t23-,24+,25+,26-,28-/m1/s1 |
| InChIKey | NDFUXHVBEIFGOD-BZTMQRDQSA-N |
| XLogP | 7.82 |
| TPSA | 46.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.92 |
| LogP ≤ 5 | 7.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|