C13H22BrN3O — CID 114780779
6-(bromomethyl)-2,2-dimethyl-4-[2-(2-methylimidazol-1-yl)ethyl]morpholine (PubChem CID 114780779) has the molecular formula C13H22BrN3O and a molecular weight of 316.24 g/mol. Its IUPAC name is 6-(bromomethyl)-2,2-dimethyl-4-[2-(2-methylimidazol-1-yl)ethyl]morpholine.
| Compound Name | 6-(bromomethyl)-2,2-dimethyl-4-[2-(2-methylimidazol-1-yl)ethyl]morpholine |
|---|---|
| PubChem CID | 114780779 |
| Molecular Formula | C13H22BrN3O |
| Molecular Weight | 316.24 g/mol |
| Exact Mass | 315.09 |
| IUPAC Name | 6-(bromomethyl)-2,2-dimethyl-4-[2-(2-methylimidazol-1-yl)ethyl]morpholine |
| SMILES | Cc1nccn1CCN1CC(CBr)OC(C)(C)C1 |
| InChI | InChI=1S/C13H22BrN3O/c1-11-15-4-5-17(11)7-6-16-9-12(8-14)18-13(2,3)10-16/h4-5,12H,6-10H2,1-3H3 |
| InChIKey | XGMMPUZZFRTZSX-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 30.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.24 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|