C11H17ClF3NO2 — CID 114781135
1-[6-(chloromethyl)-2,2-dimethylmorpholin-4-yl]-4,4,4-trifluorobutan-1-one (PubChem CID 114781135) has the molecular formula C11H17ClF3NO2 and a molecular weight of 287.71 g/mol. Its IUPAC name is 1-[6-(chloromethyl)-2,2-dimethylmorpholin-4-yl]-4,4,4-trifluorobutan-1-one.
| Compound Name | 1-[6-(chloromethyl)-2,2-dimethylmorpholin-4-yl]-4,4,4-trifluorobutan-1-one |
|---|---|
| PubChem CID | 114781135 |
| Molecular Formula | C11H17ClF3NO2 |
| Molecular Weight | 287.71 g/mol |
| Exact Mass | 287.09 |
| IUPAC Name | 1-[6-(chloromethyl)-2,2-dimethylmorpholin-4-yl]-4,4,4-trifluorobutan-1-one |
| SMILES | CC1(C)CN(C(=O)CCC(F)(F)F)CC(CCl)O1 |
| InChI | InChI=1S/C11H17ClF3NO2/c1-10(2)7-16(6-8(5-12)18-10)9(17)3-4-11(13,14)15/h8H,3-7H2,1-2H3 |
| InChIKey | QBKGIGUYXCUALB-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.71 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|