C29H41N3O5Si — CID 11478250
[(2S,3R,4R,5S,6R)-3-azido-4-phenylmethoxy-6-(phenylmethoxymethyl)-5-prop-2-enoxyoxan-2-yl]oxy-tert-butyl-dimethylsilane (PubChem CID 11478250) has the molecular formula C29H41N3O5Si and a molecular weight of 539.75 g/mol. Its IUPAC name is [(2S,3R,4R,5S,6R)-3-azido-4-phenylmethoxy-6-(phenylmethoxymethyl)-5-prop-2-enoxyoxan-2-yl]oxy-tert-butyl-dimethylsilane.
| Compound Name | [(2S,3R,4R,5S,6R)-3-azido-4-phenylmethoxy-6-(phenylmethoxymethyl)-5-prop-2-enoxyoxan-2-yl]oxy-tert-butyl-dimethylsilane |
|---|---|
| PubChem CID | 11478250 |
| Molecular Formula | C29H41N3O5Si |
| Molecular Weight | 539.75 g/mol |
| Exact Mass | 539.28 |
| IUPAC Name | [(2S,3R,4R,5S,6R)-3-azido-4-phenylmethoxy-6-(phenylmethoxymethyl)-5-prop-2-enoxyoxan-2-yl]oxy-tert-butyl-dimethylsilane |
| SMILES | C=CCO[C@H]1[C@H](OCc2ccccc2)[C@@H](N=[N+]=[N-])[C@H](O[Si](C)(C)C(C)(C)C)O[C@@H]1COCc1ccccc1 |
| InChI | InChI=1S/C29H41N3O5Si/c1-7-18-34-26-24(21-33-19-22-14-10-8-11-15-22)36-28(37-38(5,6)29(2,3)4)25(31-32-30)27(26)35-20-23-16-12-9-13-17-23/h7-17,24-28H,1,18-21H2,2-6H3/t24-,25-,26-,27-,28+/m1/s1 |
| InChIKey | USDMLLBNQFQXKY-FXGKLIOSSA-N |
| XLogP | 6.79 |
| TPSA | 94.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.75 |
| LogP ≤ 5 | 6.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|