C13H20N4O4 — CID 114782729
[6,6-dimethyl-4-[6-(methylamino)-3-nitro-2-pyridinyl]morpholin-2-yl]methanol (PubChem CID 114782729) has the molecular formula C13H20N4O4 and a molecular weight of 296.33 g/mol. Its IUPAC name is [6,6-dimethyl-4-[6-(methylamino)-3-nitro-2-pyridinyl]morpholin-2-yl]methanol.
| Compound Name | [6,6-dimethyl-4-[6-(methylamino)-3-nitro-2-pyridinyl]morpholin-2-yl]methanol |
|---|---|
| PubChem CID | 114782729 |
| Molecular Formula | C13H20N4O4 |
| Molecular Weight | 296.33 g/mol |
| Exact Mass | 296.15 |
| IUPAC Name | [6,6-dimethyl-4-[6-(methylamino)-3-nitro-2-pyridinyl]morpholin-2-yl]methanol |
| SMILES | CNc1ccc([N+](=O)[O-])c(N2CC(CO)OC(C)(C)C2)n1 |
| InChI | InChI=1S/C13H20N4O4/c1-13(2)8-16(6-9(7-18)21-13)12-10(17(19)20)4-5-11(14-3)15-12/h4-5,9,18H,6-8H2,1-3H3,(H,14,15) |
| InChIKey | MVDCPCYYCMIETD-UHFFFAOYSA-N |
| XLogP | 1.01 |
| TPSA | 100.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.33 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|