C29H60O5Si2 — CID 11478328
(E,2R,3S,4S,6R,10R,11R)-7,11-bis[[tert-butyl(dimethyl)silyl]oxy]-3-hydroxy-2,4,6,10-tetramethyltridec-8-enoic acid (PubChem CID 11478328) has the molecular formula C29H60O5Si2 and a molecular weight of 544.97 g/mol. Its IUPAC name is (E,2R,3S,4S,6R,10R,11R)-7,11-bis[[tert-butyl(dimethyl)silyl]oxy]-3-hydroxy-2,4,6,10-tetramethyltridec-8-enoic acid.
| Compound Name | (E,2R,3S,4S,6R,10R,11R)-7,11-bis[[tert-butyl(dimethyl)silyl]oxy]-3-hydroxy-2,4,6,10-tetramethyltridec-8-enoic acid |
|---|---|
| PubChem CID | 11478328 |
| Molecular Formula | C29H60O5Si2 |
| Molecular Weight | 544.97 g/mol |
| Exact Mass | 544.40 |
| IUPAC Name | (E,2R,3S,4S,6R,10R,11R)-7,11-bis[[tert-butyl(dimethyl)silyl]oxy]-3-hydroxy-2,4,6,10-tetramethyltridec-8-enoic acid |
| SMILES | CC[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](C)/C=C/C(O[Si](C)(C)C(C)(C)C)[C@H](C)C[C@H](C)[C@H](O)[C@@H](C)C(=O)O |
| InChI | InChI=1S/C29H60O5Si2/c1-16-24(33-35(12,13)28(6,7)8)20(2)17-18-25(34-36(14,15)29(9,10)11)21(3)19-22(4)26(30)23(5)27(31)32/h17-18,20-26,30H,16,19H2,1-15H3,(H,31,32)/b18-17+/t20-,21-,22+,23-,24-,25?,26+/m1/s1 |
| InChIKey | XBMPAEAUKQUYEZ-WDTREKCFSA-N |
| XLogP | 8.11 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.97 |
| LogP ≤ 5 | 8.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|