C28H25ClN4O4S — CID 11478383
2-chloro-N-[(1R,2S)-2-[[4-(2-sulfamoylphenyl)phenyl]carbamoyl]cyclopentyl]quinoline-6-carboxamide (PubChem CID 11478383) has the molecular formula C28H25ClN4O4S and a molecular weight of 549.05 g/mol. Its IUPAC name is 2-chloro-N-[(1R,2S)-2-[[4-(2-sulfamoylphenyl)phenyl]carbamoyl]cyclopentyl]quinoline-6-carboxamide.
| Compound Name | 2-chloro-N-[(1R,2S)-2-[[4-(2-sulfamoylphenyl)phenyl]carbamoyl]cyclopentyl]quinoline-6-carboxamide |
|---|---|
| PubChem CID | 11478383 |
| Molecular Formula | C28H25ClN4O4S |
| Molecular Weight | 549.05 g/mol |
| Exact Mass | 548.13 |
| IUPAC Name | 2-chloro-N-[(1R,2S)-2-[[4-(2-sulfamoylphenyl)phenyl]carbamoyl]cyclopentyl]quinoline-6-carboxamide |
| SMILES | NS(=O)(=O)c1ccccc1-c1ccc(NC(=O)[C@H]2CCC[C@H]2NC(=O)c2ccc3nc(Cl)ccc3c2)cc1 |
| InChI | InChI=1S/C28H25ClN4O4S/c29-26-15-11-18-16-19(10-14-23(18)32-26)27(34)33-24-6-3-5-22(24)28(35)31-20-12-8-17(9-13-20)21-4-1-2-7-25(21)38(30,36)37/h1-2,4,7-16,22,24H,3,5-6H2,(H,31,35)(H,33,34)(H2,30,36,37)/t22-,24+/m0/s1 |
| InChIKey | VQGIFGMHBWGMSM-LADGPHEKSA-N |
| XLogP | 4.74 |
| TPSA | 131.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.05 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|