C31H34N4O6 — CID 11478504
2-[[(2S)-1-hydroxy-3-phenylpropan-2-yl]amino]-N-(2-phenoxyethyl)-4-(3,4,5-trimethoxyphenyl)pyrimidine-5-carboxamide (PubChem CID 11478504) has the molecular formula C31H34N4O6 and a molecular weight of 558.64 g/mol. Its IUPAC name is 2-[[(2S)-1-hydroxy-3-phenylpropan-2-yl]amino]-N-(2-phenoxyethyl)-4-(3,4,5-trimethoxyphenyl)pyrimidine-5-carboxamide.
| Compound Name | 2-[[(2S)-1-hydroxy-3-phenylpropan-2-yl]amino]-N-(2-phenoxyethyl)-4-(3,4,5-trimethoxyphenyl)pyrimidine-5-carboxamide |
|---|---|
| PubChem CID | 11478504 |
| Molecular Formula | C31H34N4O6 |
| Molecular Weight | 558.64 g/mol |
| Exact Mass | 558.25 |
| IUPAC Name | 2-[[(2S)-1-hydroxy-3-phenylpropan-2-yl]amino]-N-(2-phenoxyethyl)-4-(3,4,5-trimethoxyphenyl)pyrimidine-5-carboxamide |
| SMILES | COc1cc(-c2nc(N[C@H](CO)Cc3ccccc3)ncc2C(=O)NCCOc2ccccc2)cc(OC)c1OC |
| InChI | InChI=1S/C31H34N4O6/c1-38-26-17-22(18-27(39-2)29(26)40-3)28-25(30(37)32-14-15-41-24-12-8-5-9-13-24)19-33-31(35-28)34-23(20-36)16-21-10-6-4-7-11-21/h4-13,17-19,23,36H,14-16,20H2,1-3H3,(H,32,37)(H,33,34,35)/t23-/m0/s1 |
| InChIKey | XYWFFBKDRAMPBZ-QHCPKHFHSA-N |
| XLogP | 3.99 |
| TPSA | 124.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.64 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|