C25H40FN3O6P2 — CID 11478514
N'-[5-[bis(diethoxyphosphoryl)methyl]-2-fluorophenyl]-N,N'-dimethyl-N-pyridin-2-ylpropane-1,3-diamine (PubChem CID 11478514) has the molecular formula C25H40FN3O6P2 and a molecular weight of 559.56 g/mol. Its IUPAC name is N'-[5-[bis(diethoxyphosphoryl)methyl]-2-fluorophenyl]-N,N'-dimethyl-N-pyridin-2-ylpropane-1,3-diamine.
| Compound Name | N'-[5-[bis(diethoxyphosphoryl)methyl]-2-fluorophenyl]-N,N'-dimethyl-N-pyridin-2-ylpropane-1,3-diamine |
|---|---|
| PubChem CID | 11478514 |
| Molecular Formula | C25H40FN3O6P2 |
| Molecular Weight | 559.56 g/mol |
| Exact Mass | 559.24 |
| IUPAC Name | N'-[5-[bis(diethoxyphosphoryl)methyl]-2-fluorophenyl]-N,N'-dimethyl-N-pyridin-2-ylpropane-1,3-diamine |
| SMILES | CCOP(=O)(OCC)C(c1ccc(F)c(N(C)CCCN(C)c2ccccn2)c1)P(=O)(OCC)OCC |
| InChI | InChI=1S/C25H40FN3O6P2/c1-7-32-36(30,33-8-2)25(37(31,34-9-3)35-10-4)21-15-16-22(26)23(20-21)28(5)18-13-19-29(6)24-14-11-12-17-27-24/h11-12,14-17,20,25H,7-10,13,18-19H2,1-6H3 |
| InChIKey | YTHJPOPQLAUREH-UHFFFAOYSA-N |
| XLogP | 6.71 |
| TPSA | 90.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.56 |
| LogP ≤ 5 | 6.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|