C30H40N6O3Si — CID 11478533
1-[(2R)-4-[6-(benzylcarbamoylamino)indol-1-yl]-1-[tert-butyl(dimethyl)silyl]oxybutan-2-yl]imidazole-4-carboxamide (PubChem CID 11478533) has the molecular formula C30H40N6O3Si and a molecular weight of 560.78 g/mol. Its IUPAC name is 1-[(2R)-4-[6-(benzylcarbamoylamino)indol-1-yl]-1-[tert-butyl(dimethyl)silyl]oxybutan-2-yl]imidazole-4-carboxamide.
| Compound Name | 1-[(2R)-4-[6-(benzylcarbamoylamino)indol-1-yl]-1-[tert-butyl(dimethyl)silyl]oxybutan-2-yl]imidazole-4-carboxamide |
|---|---|
| PubChem CID | 11478533 |
| Molecular Formula | C30H40N6O3Si |
| Molecular Weight | 560.78 g/mol |
| Exact Mass | 560.29 |
| IUPAC Name | 1-[(2R)-4-[6-(benzylcarbamoylamino)indol-1-yl]-1-[tert-butyl(dimethyl)silyl]oxybutan-2-yl]imidazole-4-carboxamide |
| SMILES | CC(C)(C)[Si](C)(C)OC[C@@H](CCn1ccc2ccc(NC(=O)NCc3ccccc3)cc21)n1cnc(C(N)=O)c1 |
| InChI | InChI=1S/C30H40N6O3Si/c1-30(2,3)40(4,5)39-20-25(36-19-26(28(31)37)33-21-36)14-16-35-15-13-23-11-12-24(17-27(23)35)34-29(38)32-18-22-9-7-6-8-10-22/h6-13,15,17,19,21,25H,14,16,18,20H2,1-5H3,(H2,31,37)(H2,32,34,38)/t25-/m1/s1 |
| InChIKey | YYZWGLURDGIHGL-RUZDIDTESA-N |
| XLogP | 5.91 |
| TPSA | 116.20 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.78 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|