C10H16N6O — CID 114787140
1-(5,6-dimethyl-1,2,4-triazin-3-yl)piperazine-2-carboxamide (PubChem CID 114787140) has the molecular formula C10H16N6O and a molecular weight of 236.28 g/mol. Its IUPAC name is 1-(5,6-dimethyl-1,2,4-triazin-3-yl)piperazine-2-carboxamide.
| Compound Name | 1-(5,6-dimethyl-1,2,4-triazin-3-yl)piperazine-2-carboxamide |
|---|---|
| PubChem CID | 114787140 |
| Molecular Formula | C10H16N6O |
| Molecular Weight | 236.28 g/mol |
| Exact Mass | 236.14 |
| IUPAC Name | 1-(5,6-dimethyl-1,2,4-triazin-3-yl)piperazine-2-carboxamide |
| SMILES | Cc1nnc(N2CCNCC2C(N)=O)nc1C |
| InChI | InChI=1S/C10H16N6O/c1-6-7(2)14-15-10(13-6)16-4-3-12-5-8(16)9(11)17/h8,12H,3-5H2,1-2H3,(H2,11,17) |
| InChIKey | WRFLWDJDTZQTTF-UHFFFAOYSA-N |
| XLogP | -1.25 |
| TPSA | 97.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.28 |
| LogP ≤ 5 | -1.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |