About 4-[(5,6-dimethyl-1,2,4-triazin-3-yl)sulfanyl]aniline
4-[(5,6-dimethyl-1,2,4-triazin-3-yl)sulfanyl]aniline (PubChem CID 114787439) has the molecular formula C11H12N4S
and a molecular weight of 232.31 g/mol. Its IUPAC name is 4-[(5,6-dimethyl-1,2,4-triazin-3-yl)sulfanyl]aniline.
Molecular Properties
| Compound Name | 4-[(5,6-dimethyl-1,2,4-triazin-3-yl)sulfanyl]aniline |
| PubChem CID | 114787439 |
| Molecular Formula | C11H12N4S |
| Molecular Weight | 232.31 g/mol |
| Exact Mass | 232.08 |
| IUPAC Name | 4-[(5,6-dimethyl-1,2,4-triazin-3-yl)sulfanyl]aniline |
| SMILES | Cc1nnc(Sc2ccc(N)cc2)nc1C |
| InChI | InChI=1S/C11H12N4S/c1-7-8(2)14-15-11(13-7)16-10-5-3-9(12)4-6-10/h3-6H,12H2,1-2H3 |
| InChIKey | QLUMUNAQVYBPMV-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 64.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 232.31 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 4-[(5,6-dimethyl-1,2,4-triazin-3-yl)sulfanyl]aniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[(5,6-dimethyl-1,2,4-triazin-3-yl)sulfanyl]aniline?
The IUPAC name of 4-[(5,6-dimethyl-1,2,4-triazin-3-yl)sulfanyl]aniline (CID 114787439) is 4-[(5,6-dimethyl-1,2,4-triazin-3-yl)sulfanyl]aniline.
What is the SMILES notation for 4-[(5,6-dimethyl-1,2,4-triazin-3-yl)sulfanyl]aniline?
The canonical SMILES for 4-[(5,6-dimethyl-1,2,4-triazin-3-yl)sulfanyl]aniline is Cc1nnc(Sc2ccc(N)cc2)nc1C.
What is the InChIKey of 4-[(5,6-dimethyl-1,2,4-triazin-3-yl)sulfanyl]aniline?
The InChIKey is QLUMUNAQVYBPMV-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H12N4S/c1-7-8(2)14-15-11(13-7)16-10-5-3-9(12)4-6-10/h3-6H,12H2,1-2H3.
What are the key properties of 4-[(5,6-dimethyl-1,2,4-triazin-3-yl)sulfanyl]aniline?
4-[(5,6-dimethyl-1,2,4-triazin-3-yl)sulfanyl]aniline has a molecular weight of 232.31 g/mol, XLogP of 2.22, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(5,6-dimethyl-1,2,4-triazin-3-yl)sulfanyl]aniline is sourced from PubChem (CID 114787439), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).