C8H9N7S — CID 114787716
1-(5,6-dimethyl-1,2,4-triazin-3-yl)-1,2,4-triazole-3-carbothioamide (PubChem CID 114787716) has the molecular formula C8H9N7S and a molecular weight of 235.28 g/mol. Its IUPAC name is 1-(5,6-dimethyl-1,2,4-triazin-3-yl)-1,2,4-triazole-3-carbothioamide.
| Compound Name | 1-(5,6-dimethyl-1,2,4-triazin-3-yl)-1,2,4-triazole-3-carbothioamide |
|---|---|
| PubChem CID | 114787716 |
| Molecular Formula | C8H9N7S |
| Molecular Weight | 235.28 g/mol |
| Exact Mass | 235.06 |
| IUPAC Name | 1-(5,6-dimethyl-1,2,4-triazin-3-yl)-1,2,4-triazole-3-carbothioamide |
| SMILES | Cc1nnc(-n2cnc(C(N)=S)n2)nc1C |
| InChI | InChI=1S/C8H9N7S/c1-4-5(2)12-13-8(11-4)15-3-10-7(14-15)6(9)16/h3H,1-2H3,(H2,9,16) |
| InChIKey | YLMWBRHSAWKCEU-UHFFFAOYSA-N |
| XLogP | -0.30 |
| TPSA | 95.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.28 |
| LogP ≤ 5 | -0.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|