C11H17ClN4 — CID 114787772
3-[4-(chloromethyl)piperidin-1-yl]-5,6-dimethyl-1,2,4-triazine (PubChem CID 114787772) has the molecular formula C11H17ClN4 and a molecular weight of 240.74 g/mol. Its IUPAC name is 3-[4-(chloromethyl)piperidin-1-yl]-5,6-dimethyl-1,2,4-triazine.
| Compound Name | 3-[4-(chloromethyl)piperidin-1-yl]-5,6-dimethyl-1,2,4-triazine |
|---|---|
| PubChem CID | 114787772 |
| Molecular Formula | C11H17ClN4 |
| Molecular Weight | 240.74 g/mol |
| Exact Mass | 240.11 |
| IUPAC Name | 3-[4-(chloromethyl)piperidin-1-yl]-5,6-dimethyl-1,2,4-triazine |
| SMILES | Cc1nnc(N2CCC(CCl)CC2)nc1C |
| InChI | InChI=1S/C11H17ClN4/c1-8-9(2)14-15-11(13-8)16-5-3-10(7-12)4-6-16/h10H,3-7H2,1-2H3 |
| InChIKey | CLISLVWHWRYZCK-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 41.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.74 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|