C12H19ClN4 — CID 114787780
3-[2-(3-chloropropyl)pyrrolidin-1-yl]-5,6-dimethyl-1,2,4-triazine (PubChem CID 114787780) has the molecular formula C12H19ClN4 and a molecular weight of 254.76 g/mol. Its IUPAC name is 3-[2-(3-chloropropyl)pyrrolidin-1-yl]-5,6-dimethyl-1,2,4-triazine.
| Compound Name | 3-[2-(3-chloropropyl)pyrrolidin-1-yl]-5,6-dimethyl-1,2,4-triazine |
|---|---|
| PubChem CID | 114787780 |
| Molecular Formula | C12H19ClN4 |
| Molecular Weight | 254.76 g/mol |
| Exact Mass | 254.13 |
| IUPAC Name | 3-[2-(3-chloropropyl)pyrrolidin-1-yl]-5,6-dimethyl-1,2,4-triazine |
| SMILES | Cc1nnc(N2CCCC2CCCCl)nc1C |
| InChI | InChI=1S/C12H19ClN4/c1-9-10(2)15-16-12(14-9)17-8-4-6-11(17)5-3-7-13/h11H,3-8H2,1-2H3 |
| InChIKey | UGHQRCWYZGIRBR-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 41.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.76 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|