C10H15BrN4O — CID 114787902
2-(bromomethyl)-4-(5,6-dimethyl-1,2,4-triazin-3-yl)morpholine (PubChem CID 114787902) has the molecular formula C10H15BrN4O and a molecular weight of 287.16 g/mol. Its IUPAC name is 2-(bromomethyl)-4-(5,6-dimethyl-1,2,4-triazin-3-yl)morpholine.
| Compound Name | 2-(bromomethyl)-4-(5,6-dimethyl-1,2,4-triazin-3-yl)morpholine |
|---|---|
| PubChem CID | 114787902 |
| Molecular Formula | C10H15BrN4O |
| Molecular Weight | 287.16 g/mol |
| Exact Mass | 286.04 |
| IUPAC Name | 2-(bromomethyl)-4-(5,6-dimethyl-1,2,4-triazin-3-yl)morpholine |
| SMILES | Cc1nnc(N2CCOC(CBr)C2)nc1C |
| InChI | InChI=1S/C10H15BrN4O/c1-7-8(2)13-14-10(12-7)15-3-4-16-9(5-11)6-15/h9H,3-6H2,1-2H3 |
| InChIKey | HFLAYVCISUQVIC-UHFFFAOYSA-N |
| XLogP | 1.09 |
| TPSA | 51.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.16 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|