About N'-propyl-N'-quinazolin-2-ylpropane-1,3-diamine
N'-propyl-N'-quinazolin-2-ylpropane-1,3-diamine (PubChem CID 114788667) has the molecular formula C14H20N4
and a molecular weight of 244.34 g/mol. Its IUPAC name is N'-propyl-N'-quinazolin-2-ylpropane-1,3-diamine.
Molecular Properties
| Compound Name | N'-propyl-N'-quinazolin-2-ylpropane-1,3-diamine |
| PubChem CID | 114788667 |
| Molecular Formula | C14H20N4 |
| Molecular Weight | 244.34 g/mol |
| Exact Mass | 244.17 |
| IUPAC Name | N'-propyl-N'-quinazolin-2-ylpropane-1,3-diamine |
| SMILES | CCCN(CCCN)c1ncc2ccccc2n1 |
| InChI | InChI=1S/C14H20N4/c1-2-9-18(10-5-8-15)14-16-11-12-6-3-4-7-13(12)17-14/h3-4,6-7,11H,2,5,8-10,15H2,1H3 |
| InChIKey | QVRUQUBYRXAFJT-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 55.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 244.34 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N'-propyl-N'-quinazolin-2-ylpropane-1,3-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-propyl-N'-quinazolin-2-ylpropane-1,3-diamine?
The IUPAC name of N'-propyl-N'-quinazolin-2-ylpropane-1,3-diamine (CID 114788667) is N'-propyl-N'-quinazolin-2-ylpropane-1,3-diamine.
What is the SMILES notation for N'-propyl-N'-quinazolin-2-ylpropane-1,3-diamine?
The canonical SMILES for N'-propyl-N'-quinazolin-2-ylpropane-1,3-diamine is CCCN(CCCN)c1ncc2ccccc2n1.
What is the InChIKey of N'-propyl-N'-quinazolin-2-ylpropane-1,3-diamine?
The InChIKey is QVRUQUBYRXAFJT-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H20N4/c1-2-9-18(10-5-8-15)14-16-11-12-6-3-4-7-13(12)17-14/h3-4,6-7,11H,2,5,8-10,15H2,1H3.
What are the key properties of N'-propyl-N'-quinazolin-2-ylpropane-1,3-diamine?
N'-propyl-N'-quinazolin-2-ylpropane-1,3-diamine has a molecular weight of 244.34 g/mol, XLogP of 2.19, 6 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N'-propyl-N'-quinazolin-2-ylpropane-1,3-diamine is sourced from PubChem (CID 114788667), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).