C25H30F3N3O4 — CID 11478997
1-[(3aS,6R,7aS)-3a-(3,4-dimethoxyphenyl)-1-methyl-3,4,5,6,7,7a-hexahydro-2H-indol-6-yl]-3-[4-(trifluoromethoxy)phenyl]urea (PubChem CID 11478997) has the molecular formula C25H30F3N3O4 and a molecular weight of 493.53 g/mol. Its IUPAC name is 1-[(3aS,6R,7aS)-3a-(3,4-dimethoxyphenyl)-1-methyl-3,4,5,6,7,7a-hexahydro-2H-indol-6-yl]-3-[4-(trifluoromethoxy)phenyl]urea.
| Compound Name | 1-[(3aS,6R,7aS)-3a-(3,4-dimethoxyphenyl)-1-methyl-3,4,5,6,7,7a-hexahydro-2H-indol-6-yl]-3-[4-(trifluoromethoxy)phenyl]urea |
|---|---|
| PubChem CID | 11478997 |
| Molecular Formula | C25H30F3N3O4 |
| Molecular Weight | 493.53 g/mol |
| Exact Mass | 493.22 |
| IUPAC Name | 1-[(3aS,6R,7aS)-3a-(3,4-dimethoxyphenyl)-1-methyl-3,4,5,6,7,7a-hexahydro-2H-indol-6-yl]-3-[4-(trifluoromethoxy)phenyl]urea |
| SMILES | COc1ccc([C@@]23CC[C@@H](NC(=O)Nc4ccc(OC(F)(F)F)cc4)C[C@@H]2N(C)CC3)cc1OC |
| InChI | InChI=1S/C25H30F3N3O4/c1-31-13-12-24(16-4-9-20(33-2)21(14-16)34-3)11-10-18(15-22(24)31)30-23(32)29-17-5-7-19(8-6-17)35-25(26,27)28/h4-9,14,18,22H,10-13,15H2,1-3H3,(H2,29,30,32)/t18-,22+,24+/m1/s1 |
| InChIKey | NQGLXXWMQXPIHF-OUOWLKGYSA-N |
| XLogP | 4.92 |
| TPSA | 72.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.53 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |